2,7-Diiodonaphthalene, 97%
cas: 58556-77-7 — see every product listed under this CAS number, including other names
2,7-Diiodonaphthalene, 97% (CAS 58556-77-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F863657-100MG |
| cas | 58556-77-7 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 544.62 Pln | |
| Fluorochem | 250mg | 857.01 Pln | |
| Fluorochem | 1g | 2169.05 Pln | |
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 1076.81 Pln | |
| Ambeed | 5g | 4748.06 Pln | |
| Chemat | 100mg | 376.40 Pln | |
| Chemat | 250mg | 597.20 Pln | |
| Chemat | 1g | 1504.40 Pln | |
| BLDpharm | 100mg | 353.23 Pln | |
| BLDpharm | 250mg | 497.63 Pln | |
| BLDpharm | 1g | 1152.95 Pln | |
| BLDpharm | 5g | 5112.67 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
2,7-diiodonaphthalene (CAS 58556-77-7) is a chemical compound with the molecular formula C10H6I2 and a molecular weight of 379.96 g/mol. IUPAC name: 2,7-diiodonaphthalene. InChIKey: VKWGMCDDHNYOBD-UHFFFAOYSA-N.
| Molecular formula | C10H6I2 |
|---|---|
| Molecular weight | 379.96 g/mol |
| IUPAC name | 2,7-diiodonaphthalene |
| InChIKey | VKWGMCDDHNYOBD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=C2)I)I |
Computed by PubChem (NCBI)
Synonyms:
2,7-Diiodonaphthalene