CAS 1730-04-7 appears in our catalog under these names: 1,8-Diiodonaphthalene, 98%, 1,8-Diiodonaphthalene, 95+%, 1,8-Diiodonaphthalene 98%, 1,8-Diiodonaphthalene, 99%+, 99%+. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg.
1,8-diiodonaphthalene (CAS 1730-04-7) is a chemical compound with the molecular formula C10H6I2 and a molecular weight of 379.96 g/mol. IUPAC name: 1,8-diiodonaphthalene. InChIKey: FURHMGVKKGEGMZ-UHFFFAOYSA-N.
| Molecular formula | C10H6I2 |
|---|---|
| Molecular weight | 379.96 g/mol |
| IUPAC name | 1,8-diiodonaphthalene |
| InChIKey | FURHMGVKKGEGMZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)I)C(=CC=C2)I |
Computed by PubChem (NCBI)