cas: 5941-07-1 — see every product listed under this CAS number, including other names
2,7-Naphthalenedisulfonic acid, 4-hydroxy-5-[[(2-hydroxyphenyl)methylene]amino]-, sodium salt (1:1), 97%, 97% (CAS 5941-07-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114NY0-100mg |
| cas | 5941-07-1 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 381.20 Pln | |
| Chemat | 25g | 947.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Sodium 4-hydroxy-5-[(2-hydroxyphenyl)methylideneamino]-7-sulfonaphthalene-2-sulfonate (CAS 5941-07-1) is a chemical compound with the molecular formula C17H12NNaO8S2 and a molecular weight of 445.4 g/mol. IUPAC name: sodium 4-hydroxy-5-[(2-hydroxyphenyl)methylideneamino]-7-sulfonaphthalene-2-sulfonate. InChIKey: VDMRMECRCLGIAD-UHFFFAOYSA-M.
| Molecular formula | C17H12NNaO8S2 |
|---|---|
| Molecular weight | 445.4 g/mol |
| IUPAC name | sodium 4-hydroxy-5-[(2-hydroxyphenyl)methylideneamino]-7-sulfonaphthalene-2-sulfonate |
| InChIKey | VDMRMECRCLGIAD-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)C=NC2=C3C(=CC(=C2)S(=O)(=O)O)C=C(C=C3O)S(=O)(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)