CAS 5941-07-1 appears in our catalog under these names: 2,7-Naphthalenedisulfonic acid, 4-hydroxy-5-[[(2-hydroxyphenyl)methylene]amino]-, sodium salt (1:1), 97%, 97%, 4-Hydroxy-5-[salicylideneamino]-2,7-naphthalenedisulfonic acid sodium salt, 97%, Azomethine-H Monosodium (>90%), Azomethine–H monosodium, Azomethine H Monosodium Salt [Spectrophotometric Reagent for B], >97.0%(T). Offered by: Chemat, Combi-blocks, TRC, GLPBio, TCI. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 500mg, 10g, 50g.
Sodium 4-hydroxy-5-[(2-hydroxyphenyl)methylideneamino]-7-sulfonaphthalene-2-sulfonate (CAS 5941-07-1) is a chemical compound with the molecular formula C17H12NNaO8S2 and a molecular weight of 445.4 g/mol. IUPAC name: sodium 4-hydroxy-5-[(2-hydroxyphenyl)methylideneamino]-7-sulfonaphthalene-2-sulfonate. InChIKey: VDMRMECRCLGIAD-UHFFFAOYSA-M.
| Molecular formula | C17H12NNaO8S2 |
|---|---|
| Molecular weight | 445.4 g/mol |
| IUPAC name | sodium 4-hydroxy-5-[(2-hydroxyphenyl)methylideneamino]-7-sulfonaphthalene-2-sulfonate |
| InChIKey | VDMRMECRCLGIAD-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)C=NC2=C3C(=CC(=C2)S(=O)(=O)O)C=C(C=C3O)S(=O)(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)