cas: 144918-96-7 — see every product listed under this CAS number, including other names
2,8-Dichloroquinoline-3-carbaldehyde (CAS 144918-96-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F092841-250MG |
| cas | 144918-96-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 263.47 Pln |
| delivery time | 3-4 weeks |
|---|
2,8-dichloroquinoline-3-carbaldehyde (CAS 144918-96-7) is a chemical compound with the molecular formula C10H5Cl2NO and a molecular weight of 226.06 g/mol. IUPAC name: 2,8-dichloroquinoline-3-carbaldehyde. InChIKey: LPMXEZKNTOGEMM-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO |
|---|---|
| Molecular weight | 226.06 g/mol |
| IUPAC name | 2,8-dichloroquinoline-3-carbaldehyde |
| InChIKey | LPMXEZKNTOGEMM-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C(N=C2C(=C1)Cl)Cl)C=O |
Computed by PubChem (NCBI)