2,8-Dichloroquinoline-3-carboxaldehyde, ≥97-<99%
cas: 144918-96-7 — see every product listed under this CAS number, including other names
2,8-Dichloroquinoline-3-carboxaldehyde, ≥97-<99% (CAS 144918-96-7) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC1230-97-99-25g |
| cas | 144918-96-7 |
| size | 25g |
| availability | 3-4 tygodnie|3-4 weeks |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 25g | 6758.18 Pln | |
| Hoffman Fine Chemicals | 50g | 10637.22 Pln | |
| Hoffman Fine Chemicals | 100g | 16832.20 Pln | |
| Hoffman Fine Chemicals | 200g | 26740.34 Pln | |
| Hoffman Fine Chemicals | 300g | 35991.34 Pln | |
| Hoffman Fine Chemicals | 400g | 43124.18 Pln |
properties
| purity | ≥97-<99% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
2,8-dichloroquinoline-3-carbaldehyde (CAS 144918-96-7) is a chemical compound with the molecular formula C10H5Cl2NO and a molecular weight of 226.06 g/mol. IUPAC name: 2,8-dichloroquinoline-3-carbaldehyde. InChIKey: LPMXEZKNTOGEMM-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO |
|---|---|
| Molecular weight | 226.06 g/mol |
| IUPAC name | 2,8-dichloroquinoline-3-carbaldehyde |
| InChIKey | LPMXEZKNTOGEMM-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C(N=C2C(=C1)Cl)Cl)C=O |
Computed by PubChem (NCBI)