cas: 865203-79-8 — see every product listed under this CAS number, including other names
2–(4–ethylpiperazin–1–yl)benzaldehyde (CAS 865203-79-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 50mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD12640-1g |
| cas | 865203-79-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 2913.89 Pln | |
| GLPBio | 250mg | 1631.43 Pln | |
| GLPBio | 50mg | 760.86 Pln | |
| GLPBio | 5g | 6199.60 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(4-ethylpiperazin-1-yl)benzaldehyde (CAS 865203-79-8) is a chemical compound with the molecular formula C13H18N2O and a molecular weight of 218.29 g/mol. IUPAC name: 2-(4-ethylpiperazin-1-yl)benzaldehyde. InChIKey: PCAHVXDDADHPLQ-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O |
|---|---|
| Molecular weight | 218.29 g/mol |
| IUPAC name | 2-(4-ethylpiperazin-1-yl)benzaldehyde |
| InChIKey | PCAHVXDDADHPLQ-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CC1)C2=CC=CC=C2C=O |
Computed by PubChem (NCBI)