cas: 865203-79-8 — see every product listed under this CAS number, including other names
2-(4-Ethyl-1-piperazinyl)benzaldehyde, 97%, 97% (CAS 865203-79-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115PSX-50mg |
| cas | 865203-79-8 |
| size | 50mg |
| availability | 35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 400.40 Pln | |
| Chemat | 250mg | 1288.40 Pln | |
| Chemat | 1g | 2584.40 Pln | |
| Chemat | 5g | 5901.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(4-ethylpiperazin-1-yl)benzaldehyde (CAS 865203-79-8) is a chemical compound with the molecular formula C13H18N2O and a molecular weight of 218.29 g/mol. IUPAC name: 2-(4-ethylpiperazin-1-yl)benzaldehyde. InChIKey: PCAHVXDDADHPLQ-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O |
|---|---|
| Molecular weight | 218.29 g/mol |
| IUPAC name | 2-(4-ethylpiperazin-1-yl)benzaldehyde |
| InChIKey | PCAHVXDDADHPLQ-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CC1)C2=CC=CC=C2C=O |
Computed by PubChem (NCBI)