cas: 5626-99-3 — see every product listed under this CAS number, including other names
2’-Deoxy-5,6-dihydrouridine, ≥95%, ≥95% (CAS 5626-99-3) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D0ZK-5mg |
| cas | 5626-99-3 |
| size | 5mg |
| availability | 0.6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 712.40 Pln | |
| Chemat | 10mg | 1101.20 Pln | |
| Chemat | 25mg | 1941.20 Pln | |
| Chemat | 50mg | 2982.80 Pln | |
| Chemat | 100mg | 5003.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-diazinane-2,4-dione (CAS 5626-99-3) is a chemical compound with the molecular formula C9H14N2O5 and a molecular weight of 230.22 g/mol. IUPAC name: 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-diazinane-2,4-dione. InChIKey: XMJRLEURHMTTRX-SHYZEUOFSA-N.
| Molecular formula | C9H14N2O5 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-diazinane-2,4-dione |
| InChIKey | XMJRLEURHMTTRX-SHYZEUOFSA-N |
| SMILES | C1CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CO)O |
Computed by PubChem (NCBI)