cas: 94026-73-0 — see every product listed under this CAS number, including other names
2,4–dimethyl–N–(4–methylphenyl)aniline (CAS 94026-73-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF38947-1g |
| cas | 94026-73-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 1196.14 Pln | |
| GLPBio | 250mg | 676.61 Pln | |
| GLPBio | 5g | 3424.06 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2,4-dimethyl-N-(4-methylphenyl)aniline (CAS 94026-73-0) is a chemical compound with the molecular formula C15H17N and a molecular weight of 211.30 g/mol. IUPAC name: 2,4-dimethyl-N-(4-methylphenyl)aniline. InChIKey: LAQZTCAFWPQEQO-UHFFFAOYSA-N.
| Molecular formula | C15H17N |
|---|---|
| Molecular weight | 211.30 g/mol |
| IUPAC name | 2,4-dimethyl-N-(4-methylphenyl)aniline |
| InChIKey | LAQZTCAFWPQEQO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=C(C=C(C=C2)C)C |
Computed by PubChem (NCBI)