cas: 135944-07-9 — see every product listed under this CAS number, including other names
2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2,3-dihydro-1H-indene-2-carboxylic acid, 96%, 96% (CAS 135944-07-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110AI3-50mg |
| cas | 135944-07-9 |
| size | 50mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 184.40 Pln | |
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 371.60 Pln | |
| Chemat | 1g | 890.00 Pln | |
| Chemat | 5g | 2819.60 Pln | |
| Chemat | 10g | 4197.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-(9H-fluoren-9-ylmethoxycarbonylamino)-1,3-dihydroindene-2-carboxylic acid (CAS 135944-07-9) is a chemical compound with the molecular formula C25H21NO4 and a molecular weight of 399.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-1,3-dihydroindene-2-carboxylic acid. InChIKey: MCDKTZLMNAVTIJ-UHFFFAOYSA-N.
| Molecular formula | C25H21NO4 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-1,3-dihydroindene-2-carboxylic acid |
| InChIKey | MCDKTZLMNAVTIJ-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2CC1(C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)