CAS 204320-45-6 appears in our catalog under these names: Fmoc-trans-3-phenylazetidine-2-carboxylic acid, 95%, Racemic Fmoc-trans-3-phenylazetidine-2-carboxylic acid, Fmoc-trans-3-phenylazetidine-2-carboxylic Acid, Fmoc-trans-3-phenylazetidine-2-carboxylicacid 96% (HPLC), Racemic Fmoc-trans-3-phenylazetidine-2-carboxylic acid, 96%. Offered by: Combi-blocks, Creative Peptides, TRC, Ambeed, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, on request, 500mg, 50mg.
1-(9H-fluoren-9-ylmethoxycarbonyl)-3-phenylazetidine-2-carboxylic acid (CAS 204320-45-6) is a chemical compound with the molecular formula C25H21NO4 and a molecular weight of 399.4 g/mol. IUPAC name: 1-(9H-fluoren-9-ylmethoxycarbonyl)-3-phenylazetidine-2-carboxylic acid. InChIKey: SQMOPSBYDIMJRP-UHFFFAOYSA-N.
| Molecular formula | C25H21NO4 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | 1-(9H-fluoren-9-ylmethoxycarbonyl)-3-phenylazetidine-2-carboxylic acid |
| InChIKey | SQMOPSBYDIMJRP-UHFFFAOYSA-N |
| SMILES | C1C(C(N1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O)C5=CC=CC=C5 |
Computed by PubChem (NCBI)