cas: 30065-27-1 — see every product listed under this CAS number, including other names
2-((1H-Benzo[d]imidazol-2-yl)thio)acetohydrazide 95% (CAS 30065-27-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A196524-1g |
| cas | 30065-27-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 153.44 Pln | |
| Ambeed | 5g | 325.88 Pln | |
| Ambeed | 25g | 1349.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A196524 |
2-(1H-benzimidazol-2-ylsulfanyl)acetohydrazide (CAS 30065-27-1) is a chemical compound with the molecular formula C9H10N4OS and a molecular weight of 222.27 g/mol. IUPAC name: 2-(1H-benzimidazol-2-ylsulfanyl)acetohydrazide. InChIKey: UIHKXOZJFOTOCE-UHFFFAOYSA-N.
| Molecular formula | C9H10N4OS |
|---|---|
| Molecular weight | 222.27 g/mol |
| IUPAC name | 2-(1H-benzimidazol-2-ylsulfanyl)acetohydrazide |
| InChIKey | UIHKXOZJFOTOCE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)SCC(=O)NN |
Computed by PubChem (NCBI)