CAS 180727-22-4 is the registry number for 3-(Benzylsulfinyl)-1h-1,2,4-triazol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
5-benzylsulfinyl-1H-1,2,4-triazol-3-amine (CAS 180727-22-4) is a chemical compound with the molecular formula C9H10N4OS and a molecular weight of 222.27 g/mol. IUPAC name: 5-benzylsulfinyl-1H-1,2,4-triazol-3-amine. InChIKey: NSWXEKBALYZONX-UHFFFAOYSA-N.
| Molecular formula | C9H10N4OS |
|---|---|
| Molecular weight | 222.27 g/mol |
| IUPAC name | 5-benzylsulfinyl-1H-1,2,4-triazol-3-amine |
| InChIKey | NSWXEKBALYZONX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CS(=O)C2=NC(=NN2)N |
Computed by PubChem (NCBI)