2-((2,6-Difluorobenzyl)(ethoxycarbonyl)amino)-4-((dimethylamino)methyl)-5-(4-nitrophenyl)thiophene-3-carboxylic acid, 98%
cas: 1589503-95-6 — see every product listed under this CAS number, including other names
2-((2,6-Difluorobenzyl)(ethoxycarbonyl)amino)-4-((dimethylamino)methyl)-5-(4-nitrophenyl)thiophene-3-carboxylic acid, 98% (CAS 1589503-95-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12WJW6-1g |
| cas | 1589503-95-6 |
| size | 1g |
| availability | 1000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 237.20 Pln | |
| Chemat | 25g | 678.80 Pln | |
| Chemat | 100g | 1917.20 Pln | |
| Chemat | 500g | 6633.60 Pln | |
| Fluorochem | 1g | 148.92 Pln | |
| Fluorochem | 5g | 325.94 Pln | |
| Fluorochem | 25g | 976.76 Pln | |
| Fluorochem | 100g | 3262.41 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[(2,6-difluorophenyl)methyl-ethoxycarbonylamino]-4-[(dimethylamino)methyl]-5-(4-nitrophenyl)thiophene-3-carboxylic acid (CAS 1589503-95-6) is a chemical compound with the molecular formula C24H23F2N3O6S and a molecular weight of 519.5 g/mol. IUPAC name: 2-[(2,6-difluorophenyl)methyl-ethoxycarbonylamino]-4-[(dimethylamino)methyl]-5-(4-nitrophenyl)thiophene-3-carboxylic acid. InChIKey: WIZSPFRNLVKEOT-UHFFFAOYSA-N.
| Molecular formula | C24H23F2N3O6S |
|---|---|
| Molecular weight | 519.5 g/mol |
| IUPAC name | 2-[(2,6-difluorophenyl)methyl-ethoxycarbonylamino]-4-[(dimethylamino)methyl]-5-(4-nitrophenyl)thiophene-3-carboxylic acid |
| InChIKey | WIZSPFRNLVKEOT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N(CC1=C(C=CC=C1F)F)C2=C(C(=C(S2)C3=CC=C(C=C3)[N+](=O)[O-])CN(C)C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Relugolixintermediate5, Relugolix Impurity 187