cas: 2609865-25-8 — see every product listed under this CAS number, including other names
2-((3,3-Dimethoxycyclobutyl)methyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98% (CAS 2609865-25-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1616306-10g |
| cas | 2609865-25-8 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 6417.25 Pln | |
| AmBeed | 250mg | 1118.11 Pln | |
| AmBeed | 25g | 12764.50 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[(3,3-dimethoxycyclobutyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2609865-25-8) is a chemical compound with the molecular formula C13H25BO4 and a molecular weight of 256.15 g/mol. IUPAC name: 2-[(3,3-dimethoxycyclobutyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: OIZBAUJILKCWCF-UHFFFAOYSA-N.
| Molecular formula | C13H25BO4 |
|---|---|
| Molecular weight | 256.15 g/mol |
| IUPAC name | 2-[(3,3-dimethoxycyclobutyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | OIZBAUJILKCWCF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2CC(C2)(OC)OC |
Computed by PubChem (NCBI)