CAS 608534-37-8 appears in our catalog under these names: 3,3-Diethoxy-1-propenylboronic acid pinacol ester, 98%, 3,3-Diethoxy-1-propenylboronic acid pinacol ester, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
2-[(E)-3,3-diethoxyprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 608534-37-8) is a chemical compound with the molecular formula C13H25BO4 and a molecular weight of 256.15 g/mol. IUPAC name: 2-[(E)-3,3-diethoxyprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ZXGPKUGXWIEUJA-MDZDMXLPSA-N.
| Molecular formula | C13H25BO4 |
|---|---|
| Molecular weight | 256.15 g/mol |
| IUPAC name | 2-[(E)-3,3-diethoxyprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ZXGPKUGXWIEUJA-MDZDMXLPSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/C(OCC)OCC |
Computed by PubChem (NCBI)