2-((3-Fluoro-3'-methoxy-[1,1'-biphenyl]-4-yl)carbamoyl)cyclopent-1-enecarboxylic acid, 98%
cas: 717824-30-1 — see every product listed under this CAS number, including other names
2-((3-Fluoro-3'-methoxy-[1,1'-biphenyl]-4-yl)carbamoyl)cyclopent-1-enecarboxylic acid, 98% (CAS 717824-30-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 100mg, 10mg, 250mg. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch11FC29-1mg |
| cas | 717824-30-1 |
| size | 1mg |
| availability | 0.2g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 160.40 Pln | |
| Chemat | 5mg | 347.60 Pln | |
| Chemat | 25mg | 448.40 Pln | |
| Chemat | 50mg | 822.80 Pln | |
| Chemat | 100mg | 1221.20 Pln | |
| BLDpharm | 1mg | 208.84 Pln | |
| BLDpharm | 5mg | 469.86 Pln | |
| BLDpharm | 10mg | 669.79 Pln | |
| BLDpharm | 25mg | 1280.68 Pln | |
| BLDpharm | 50mg | 2130.39 Pln | |
| BLDpharm | 100mg | 3018.96 Pln | |
| BLDpharm | 250mg | 5967.92 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[[2-fluoro-4-(3-methoxyphenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid (CAS 717824-30-1) is a chemical compound with the molecular formula C20H18FNO4 and a molecular weight of 355.4 g/mol. IUPAC name: 2-[[2-fluoro-4-(3-methoxyphenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid. InChIKey: XPRDUGXOWVXZLL-UHFFFAOYSA-N.
| Molecular formula | C20H18FNO4 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | 2-[[2-fluoro-4-(3-methoxyphenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic acid |
| InChIKey | XPRDUGXOWVXZLL-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CC(=C(C=C2)NC(=O)C3=C(CCC3)C(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
Vidofludimus, 2-[[2-fluoro-4-(3-methoxyphenyl)phenyl]carbamoyl]cyclopentene-1-carboxylic Acid, 2-(3-Fluoro-3'-methoxybiphenyl-4-carbamoyl)cyclopent-1-enecarboxylic acid, vidofludimusum, 2-((2-fluoro-4-(3-methoxyphenyl)phenyl)carbamoyl)cyclopentene-1-carboxylic acid, Vidofludimus [INN], 4sc-101;SC12267, s7262, Vidofludimus(4SC-101; SC12267), Vidofludimus (USAN/INN)