cas: 864754-22-3 — see every product listed under this CAS number, including other names
2-((4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)methyl)pyridine 95% (CAS 864754-22-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A777603-100mg |
| cas | 864754-22-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 581.75 Pln | |
| Ambeed | 250mg | 948.88 Pln | |
| Ambeed | 1g | 2267.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A777603 |
2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]pyridine (CAS 864754-22-3) is a chemical compound with the molecular formula C15H20BN3O2 and a molecular weight of 285.15 g/mol. IUPAC name: 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]pyridine. InChIKey: MITHCPNYDGADHL-UHFFFAOYSA-N.
| Molecular formula | C15H20BN3O2 |
|---|---|
| Molecular weight | 285.15 g/mol |
| IUPAC name | 2-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]pyridine |
| InChIKey | MITHCPNYDGADHL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CC3=CC=CC=N3 |
Computed by PubChem (NCBI)