CAS 864754-20-1 is the registry number for 1-(4-Pyridinomethyl)pyrazole-4-boronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]pyridine (CAS 864754-20-1) is a chemical compound with the molecular formula C15H20BN3O2 and a molecular weight of 285.15 g/mol. IUPAC name: 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]pyridine. InChIKey: CYVKIEBMWMQHOR-UHFFFAOYSA-N.
| Molecular formula | C15H20BN3O2 |
|---|---|
| Molecular weight | 285.15 g/mol |
| IUPAC name | 4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]methyl]pyridine |
| InChIKey | CYVKIEBMWMQHOR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CC3=CC=NC=C3 |
Computed by PubChem (NCBI)