cas: 145872-59-9 — see every product listed under this CAS number, including other names
2-((4-AMINOBENZYL)SULFONYL)ETHANOL (CAS 145872-59-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F386460-100MG |
| cas | 145872-59-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 2814.65 Pln | |
| Fluorochem | 250mg | 5558.48 Pln | |
| Fluorochem | 1g | 10353.66 Pln |
| delivery time | 3-4 weeks |
|---|
2-[(4-aminophenyl)methylsulfonyl]ethanol (CAS 145872-59-9) is a chemical compound with the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. IUPAC name: 2-[(4-aminophenyl)methylsulfonyl]ethanol. InChIKey: HWMLEMOAAGCZRL-UHFFFAOYSA-N.
| Molecular formula | C9H13NO3S |
|---|---|
| Molecular weight | 215.27 g/mol |
| IUPAC name | 2-[(4-aminophenyl)methylsulfonyl]ethanol |
| InChIKey | HWMLEMOAAGCZRL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CS(=O)(=O)CCO)N |
Computed by PubChem (NCBI)