CAS 592542-51-3 appears in our catalog under these names: 2–((4–Methoxy–3–nitrobenzyl)sulfonyl)acetic acid, 2-(4-Methoxy-3-nitrobenzylsulfonyl)acetic acid, 95%, 2-((4-Methoxy-3-nitrobenzyl)sulfonyl)acetic acid, 98%, 98%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-[(4-methoxy-3-nitrophenyl)methylsulfonyl]acetic acid (CAS 592542-51-3) is a chemical compound with the molecular formula C10H11NO7S and a molecular weight of 289.26 g/mol. IUPAC name: 2-[(4-methoxy-3-nitrophenyl)methylsulfonyl]acetic acid. InChIKey: ZHUCRFJQVSHBJR-UHFFFAOYSA-N.
| Molecular formula | C10H11NO7S |
|---|---|
| Molecular weight | 289.26 g/mol |
| IUPAC name | 2-[(4-methoxy-3-nitrophenyl)methylsulfonyl]acetic acid |
| InChIKey | ZHUCRFJQVSHBJR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CS(=O)(=O)CC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)