Products 53298-30-9

CAS 53298-30-9 is the registry number for 2-(Methylsulfonyl)ethyl (4-nitrophenyl) carbonate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-methylsulfonylethyl (4-nitrophenyl) carbonate (CAS 53298-30-9) is a chemical compound with the molecular formula C10H11NO7S and a molecular weight of 289.26 g/mol. IUPAC name: 2-methylsulfonylethyl (4-nitrophenyl) carbonate. InChIKey: RRMVRASAASKOHS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11NO7S
Molecular weight289.26 g/mol
IUPAC name2-methylsulfonylethyl (4-nitrophenyl) carbonate
InChIKeyRRMVRASAASKOHS-UHFFFAOYSA-N
SMILESCS(=O)(=O)CCOC(=O)OC1=CC=C(C=C1)[N+](=O)[O-]

Computed by PubChem (NCBI)