CAS 53298-30-9 is the registry number for 2-(Methylsulfonyl)ethyl (4-nitrophenyl) carbonate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methylsulfonylethyl (4-nitrophenyl) carbonate (CAS 53298-30-9) is a chemical compound with the molecular formula C10H11NO7S and a molecular weight of 289.26 g/mol. IUPAC name: 2-methylsulfonylethyl (4-nitrophenyl) carbonate. InChIKey: RRMVRASAASKOHS-UHFFFAOYSA-N.
| Molecular formula | C10H11NO7S |
|---|---|
| Molecular weight | 289.26 g/mol |
| IUPAC name | 2-methylsulfonylethyl (4-nitrophenyl) carbonate |
| InChIKey | RRMVRASAASKOHS-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CCOC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)