cas: 212783-75-0 — see every product listed under this CAS number, including other names
2-((5-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-10,11-dihydro-5H-dibenzo[a,d][7]annulen-2-yl)oxy)acetic acid, 96% (CAS 212783-75-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F364143-5G |
| cas | 212783-75-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 154.13 Pln | |
| Fluorochem | 10g | 232.23 Pln | |
| Fluorochem | 25g | 497.76 Pln | |
| Fluorochem | 100g | 1820.21 Pln | |
| Fluorochem | 500g | 7094.39 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]oxy]acetic acid (CAS 212783-75-0) is a chemical compound with the molecular formula C32H27NO5 and a molecular weight of 505.6 g/mol. IUPAC name: 2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]oxy]acetic acid. InChIKey: XHOBPBDZGGKEOX-UHFFFAOYSA-N.
| Molecular formula | C32H27NO5 |
|---|---|
| Molecular weight | 505.6 g/mol |
| IUPAC name | 2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]oxy]acetic acid |
| InChIKey | XHOBPBDZGGKEOX-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)OCC(=O)O)C(C3=CC=CC=C31)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)