cas: 212783-75-0 — see every product listed under this CAS number, including other names
Fmoc-Suberol, 98.46% (CAS 212783-75-0) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 25 g, 5 g, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W009034-10 g |
| cas | 212783-75-0 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 505.45 Pln | |
| MedChemExpress | 25 g | 886.26 Pln | |
| MedChemExpress | 5 g | 361.49 Pln | |
| MedChemExpress | 1 g | 240.74 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.46% |
2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]oxy]acetic acid (CAS 212783-75-0) is a chemical compound with the molecular formula C32H27NO5 and a molecular weight of 505.6 g/mol. IUPAC name: 2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]oxy]acetic acid. InChIKey: XHOBPBDZGGKEOX-UHFFFAOYSA-N.
| Molecular formula | C32H27NO5 |
|---|---|
| Molecular weight | 505.6 g/mol |
| IUPAC name | 2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]oxy]acetic acid |
| InChIKey | XHOBPBDZGGKEOX-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)OCC(=O)O)C(C3=CC=CC=C31)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)