CAS 1082474-48-3 is the registry number for 2-((5-Acetamido-1,3,4-thiadiazol-2-yl)thio)propanoic acid, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid (CAS 1082474-48-3) is a chemical compound with the molecular formula C7H9N3O3S2 and a molecular weight of 247.3 g/mol. IUPAC name: 2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid. InChIKey: TVUKFTUCGXOBBG-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O3S2 |
|---|---|
| Molecular weight | 247.3 g/mol |
| IUPAC name | 2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid |
| InChIKey | TVUKFTUCGXOBBG-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)SC1=NN=C(S1)NC(=O)C |
Computed by PubChem (NCBI)