Products 1082474-48-3

CAS 1082474-48-3 is the registry number for 2-((5-Acetamido-1,3,4-thiadiazol-2-yl)thio)propanoic acid, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid (CAS 1082474-48-3) is a chemical compound with the molecular formula C7H9N3O3S2 and a molecular weight of 247.3 g/mol. IUPAC name: 2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid. InChIKey: TVUKFTUCGXOBBG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9N3O3S2
Molecular weight247.3 g/mol
IUPAC name2-[(5-acetamido-1,3,4-thiadiazol-2-yl)sulfanyl]propanoic acid
InChIKeyTVUKFTUCGXOBBG-UHFFFAOYSA-N
SMILESCC(C(=O)O)SC1=NN=C(S1)NC(=O)C

Computed by PubChem (NCBI)