cas: 2304634-36-2 — see every product listed under this CAS number, including other names
2-((Dihydro-2H-pyran-4(3H)-ylidene)methyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98% (CAS 2304634-36-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12WJQO-100mg |
| cas | 2304634-36-2 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 472.40 Pln | |
| Chemat | 500mg | 875.60 Pln | |
| Chemat | 1g | 1067.60 Pln | |
| Chemat | 5g | 2574.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-(oxan-4-ylidenemethyl)-1,3,2-dioxaborolane (CAS 2304634-36-2) is a chemical compound with the molecular formula C12H21BO3 and a molecular weight of 224.11 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(oxan-4-ylidenemethyl)-1,3,2-dioxaborolane. InChIKey: FYMFIPYRLVGJEP-UHFFFAOYSA-N.
| Molecular formula | C12H21BO3 |
|---|---|
| Molecular weight | 224.11 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(oxan-4-ylidenemethyl)-1,3,2-dioxaborolane |
| InChIKey | FYMFIPYRLVGJEP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C=C2CCOCC2 |
Computed by PubChem (NCBI)