CAS 212127-71-4 is the registry number for 3-(Allyloxy)prop-1-en-2-ylboronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4,4,5,5-tetramethyl-2-(3-prop-2-enoxyprop-1-en-2-yl)-1,3,2-dioxaborolane (CAS 212127-71-4) is a chemical compound with the molecular formula C12H21BO3 and a molecular weight of 224.11 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3-prop-2-enoxyprop-1-en-2-yl)-1,3,2-dioxaborolane. InChIKey: QNASSOWKHMKZMT-UHFFFAOYSA-N.
| Molecular formula | C12H21BO3 |
|---|---|
| Molecular weight | 224.11 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3-prop-2-enoxyprop-1-en-2-yl)-1,3,2-dioxaborolane |
| InChIKey | QNASSOWKHMKZMT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(=C)COCC=C |
Computed by PubChem (NCBI)