cas: 1647073-46-8 — see every product listed under this CAS number, including other names
2-((Trifluoromethyl)thio)benzo[d]isothiazol-3(2H)-one 1,1-dioxide, 98% (CAS 1647073-46-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F615952-250MG |
| cas | 1647073-46-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 409.25 Pln | |
| Fluorochem | 5g | 1762.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1,1-dioxo-2-(trifluoromethylsulfanyl)-1,2-benzothiazol-3-one (CAS 1647073-46-8) is a chemical compound with the molecular formula C8H4F3NO3S2 and a molecular weight of 283.3 g/mol. IUPAC name: 1,1-dioxo-2-(trifluoromethylsulfanyl)-1,2-benzothiazol-3-one. InChIKey: KNDYXRJLEZMPBC-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO3S2 |
|---|---|
| Molecular weight | 283.3 g/mol |
| IUPAC name | 1,1-dioxo-2-(trifluoromethylsulfanyl)-1,2-benzothiazol-3-one |
| InChIKey | KNDYXRJLEZMPBC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(S2(=O)=O)SC(F)(F)F |
Computed by PubChem (NCBI)