cas: 1647073-46-8 — see every product listed under this CAS number, including other names
N-(TRIFLUOROMETHYLTHIO)SACCHARIN, 98%, 98% (CAS 1647073-46-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 10g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11JSGU-100mg |
| cas | 1647073-46-8 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 314.00 Pln | |
| Chemat | 10g | 1514.00 Pln | |
| Chemat | 50g | 6549.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,1-dioxo-2-(trifluoromethylsulfanyl)-1,2-benzothiazol-3-one (CAS 1647073-46-8) is a chemical compound with the molecular formula C8H4F3NO3S2 and a molecular weight of 283.3 g/mol. IUPAC name: 1,1-dioxo-2-(trifluoromethylsulfanyl)-1,2-benzothiazol-3-one. InChIKey: KNDYXRJLEZMPBC-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO3S2 |
|---|---|
| Molecular weight | 283.3 g/mol |
| IUPAC name | 1,1-dioxo-2-(trifluoromethylsulfanyl)-1,2-benzothiazol-3-one |
| InChIKey | KNDYXRJLEZMPBC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(S2(=O)=O)SC(F)(F)F |
Computed by PubChem (NCBI)