CAS 63981-22-6 appears in our catalog under these names: Nitrofurantoin USP related compound A, 3-(5-Nitrofurfurylideneamino)hydantoic Acid, >95% (HPLC), 2-(1-Carbamoyl-2-((5-nitrofuran-2-yl)methylene)hydrazinyl)acetic acid, 95%, 95%, 2-(1-Carbamoyl-2-((5-nitrofuran-2-yl)methylene)hydrazinyl)acetic acid, 95%. Offered by: Chemat Brand, TRC, Chemat, Ambeed. Available pack sizes: on request, 100mg, 1g, 250mg, 5g.
2-[carbamoyl-[(E)-(5-nitrofuran-2-yl)methylideneamino]amino]acetic acid (CAS 63981-22-6) is a chemical compound with the molecular formula C8H8N4O6 and a molecular weight of 256.17 g/mol. IUPAC name: 2-[carbamoyl-[(E)-(5-nitrofuran-2-yl)methylideneamino]amino]acetic acid. InChIKey: URYZARAFMQWNPZ-XCVCLJGOSA-N.
| Molecular formula | C8H8N4O6 |
|---|---|
| Molecular weight | 256.17 g/mol |
| IUPAC name | 2-[carbamoyl-[(E)-(5-nitrofuran-2-yl)methylideneamino]amino]acetic acid |
| InChIKey | URYZARAFMQWNPZ-XCVCLJGOSA-N |
| SMILES | C1=C(OC(=C1)[N+](=O)[O-])/C=N/N(CC(=O)O)C(=O)N |
Computed by PubChem (NCBI)