CAS 17140-81-7 is the registry number for Nitrofurantoin Monohydrate, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 50mg.
1-[(E)-(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione;hydrate (CAS 17140-81-7) is a chemical compound with the molecular formula C8H8N4O6 and a molecular weight of 256.17 g/mol. IUPAC name: 1-[(E)-(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione;hydrate. InChIKey: NHBPVLAHAVEISO-JSGFVSQVSA-N.
| Molecular formula | C8H8N4O6 |
|---|---|
| Molecular weight | 256.17 g/mol |
| IUPAC name | 1-[(E)-(5-nitrofuran-2-yl)methylideneamino]imidazolidine-2,4-dione;hydrate |
| InChIKey | NHBPVLAHAVEISO-JSGFVSQVSA-N |
| SMILES | C1C(=O)NC(=O)N1/N=C/C2=CC=C(O2)[N+](=O)[O-].O |
Computed by PubChem (NCBI)