cas: 125096-15-3 — see every product listed under this CAS number, including other names
2-(10H-Phenothiazin-10-yl)acetohydrazide, 97%(LC-MS),RG, 97%(LC-MS),RG (CAS 125096-15-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111N5E-100mg |
| cas | 125096-15-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 400.40 Pln | |
| Chemat | 250mg | 630.80 Pln | |
| Chemat | 1g | 1499.60 Pln | |
| Chemat | 5g | 4845.20 Pln |
| purity | 97%(LC-MS),RG |
|---|---|
| delivery time | 3 weeks |
2-phenothiazin-10-ylacetohydrazide (CAS 125096-15-3) is a chemical compound with the molecular formula C14H13N3OS and a molecular weight of 271.34 g/mol. IUPAC name: 2-phenothiazin-10-ylacetohydrazide. InChIKey: DGGWSYPHEPMOBE-UHFFFAOYSA-N.
| Molecular formula | C14H13N3OS |
|---|---|
| Molecular weight | 271.34 g/mol |
| IUPAC name | 2-phenothiazin-10-ylacetohydrazide |
| InChIKey | DGGWSYPHEPMOBE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C3=CC=CC=C3S2)CC(=O)NN |
Computed by PubChem (NCBI)