CAS 895845-12-2 is the registry number for 2-(Benzo[d]thiazol-2-yl)-1,2,4,5,6,7-hexahydro-3H-indazol-3-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1H-indazol-3-one (CAS 895845-12-2) is a chemical compound with the molecular formula C14H13N3OS and a molecular weight of 271.34 g/mol. IUPAC name: 2-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1H-indazol-3-one. InChIKey: QWUHPPCZZXKXOQ-UHFFFAOYSA-N.
| Molecular formula | C14H13N3OS |
|---|---|
| Molecular weight | 271.34 g/mol |
| IUPAC name | 2-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1H-indazol-3-one |
| InChIKey | QWUHPPCZZXKXOQ-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=O)N(N2)C3=NC4=CC=CC=C4S3 |
Computed by PubChem (NCBI)