cas: 25373-49-3 — see every product listed under this CAS number, including other names
2-(1H-Imidazol-1-yl)benzonitrile, 98%, 98% (CAS 25373-49-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117V4S-1g |
| cas | 25373-49-3 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 525.20 Pln | |
| Chemat | 5g | 1091.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-imidazol-1-ylbenzonitrile (CAS 25373-49-3) is a chemical compound with the molecular formula C10H7N3 and a molecular weight of 169.18 g/mol. IUPAC name: 2-imidazol-1-ylbenzonitrile. InChIKey: MNKBJOSIVSQUBI-UHFFFAOYSA-N.
| Molecular formula | C10H7N3 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 2-imidazol-1-ylbenzonitrile |
| InChIKey | MNKBJOSIVSQUBI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)N2C=CN=C2 |
Computed by PubChem (NCBI)