CAS 5898-81-7 is the registry number for 3-Phenyl-2H-pyrazole-4-carbonitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 25g.
5-phenyl-1H-pyrazole-4-carbonitrile (CAS 5898-81-7) is a chemical compound with the molecular formula C10H7N3 and a molecular weight of 169.18 g/mol. IUPAC name: 5-phenyl-1H-pyrazole-4-carbonitrile. InChIKey: CJYPDGRCXRPJLB-UHFFFAOYSA-N.
| Molecular formula | C10H7N3 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 5-phenyl-1H-pyrazole-4-carbonitrile |
| InChIKey | CJYPDGRCXRPJLB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=NN2)C#N |
Computed by PubChem (NCBI)