cas: 383128-24-3 — see every product listed under this CAS number, including other names
2-(2,3-Dichlorophenyl)piperidine, 95% (CAS 383128-24-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F635844-100MG |
| cas | 383128-24-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 706.02 Pln | |
| Fluorochem | 250mg | 1216.26 Pln | |
| Fluorochem | 500mg | 1887.89 Pln | |
| Fluorochem | 1g | 2955.23 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-(2,3-dichlorophenyl)piperidine (CAS 383128-24-3) is a chemical compound with the molecular formula C11H13Cl2N and a molecular weight of 230.13 g/mol. IUPAC name: 2-(2,3-dichlorophenyl)piperidine. InChIKey: SVTIFKIPTUYJLE-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2N |
|---|---|
| Molecular weight | 230.13 g/mol |
| IUPAC name | 2-(2,3-dichlorophenyl)piperidine |
| InChIKey | SVTIFKIPTUYJLE-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)C2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)