Products 891397-61-8
CAS 891397-61-8 is the registry number for 1-(3,4-Dichlorobenzyl)pyrrolidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-[(3,4-dichlorophenyl)methyl]pyrrolidine (CAS 891397-61-8) is a chemical compound with the molecular formula C11H13Cl2N and a molecular weight of 230.13 g/mol. IUPAC name: 1-[(3,4-dichlorophenyl)methyl]pyrrolidine. InChIKey: WDZCZBAYSVRTKY-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2N |
|---|---|
| Molecular weight | 230.13 g/mol |
| IUPAC name | 1-[(3,4-dichlorophenyl)methyl]pyrrolidine |
| InChIKey | WDZCZBAYSVRTKY-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)