cas: 301819-40-9 — see every product listed under this CAS number, including other names
2-(2,3-Dioxo-2,3-dihydro-1h-indol-1-yl)-n-(3-methylphenyl)acetamide, 97% (CAS 301819-40-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F653218-50MG |
| cas | 301819-40-9 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 414.46 Pln | |
| Fluorochem | 100mg | 591.48 Pln | |
| Fluorochem | 250mg | 820.56 Pln | |
| Fluorochem | 500mg | 1257.91 Pln | |
| Fluorochem | 1g | 1596.33 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(2,3-dioxoindol-1-yl)-N-(3-methylphenyl)acetamide (CAS 301819-40-9) is a chemical compound with the molecular formula C17H14N2O3 and a molecular weight of 294.30 g/mol. IUPAC name: 2-(2,3-dioxoindol-1-yl)-N-(3-methylphenyl)acetamide. InChIKey: UTYQTGGBFCQOTL-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O3 |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | 2-(2,3-dioxoindol-1-yl)-N-(3-methylphenyl)acetamide |
| InChIKey | UTYQTGGBFCQOTL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)NC(=O)CN2C3=CC=CC=C3C(=O)C2=O |
Computed by PubChem (NCBI)