Products 114897-85-7

CAS 114897-85-7 is the registry number for 2-(4-Benzyl-1-oxophthalazin-2(1h)-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.

Structural formula: {0} (CAS {1})

2-(4-benzyl-1-oxophthalazin-2-yl)acetic acid (CAS 114897-85-7) is a chemical compound with the molecular formula C17H14N2O3 and a molecular weight of 294.30 g/mol. IUPAC name: 2-(4-benzyl-1-oxophthalazin-2-yl)acetic acid. InChIKey: QAGXMQKMEDEMJM-UHFFFAOYSA-N.

Identity
Molecular formulaC17H14N2O3
Molecular weight294.30 g/mol
IUPAC name2-(4-benzyl-1-oxophthalazin-2-yl)acetic acid
InChIKeyQAGXMQKMEDEMJM-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CC2=NN(C(=O)C3=CC=CC=C32)CC(=O)O

Computed by PubChem (NCBI)