cas: 68716-50-7 — see every product listed under this CAS number, including other names
2-(2,4-Dichlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 96%, 96% (CAS 68716-50-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114EQH-250mg |
| cas | 68716-50-7 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 323.60 Pln | |
| Chemat | 25g | 890.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-(2,4-dichlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 68716-50-7) is a chemical compound with the molecular formula C12H15BCl2O2 and a molecular weight of 273.0 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: SMSBTAPKLZZTAU-UHFFFAOYSA-N.
| Molecular formula | C12H15BCl2O2 |
|---|---|
| Molecular weight | 273.0 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | SMSBTAPKLZZTAU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)