CAS 401797-02-2 appears in our catalog under these names: 2-(3,4-Dichlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98%, 2-(3,4-Dichlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 3,4–Dichlorophenylboronic acid, pinacol ester, 3,4-Dichlorophenylboronic acid pinacol ester, 2-(3,4-Dichlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%. Offered by: Ambeed, Fluorochem, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 2,5g.
2-(3,4-dichlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 401797-02-2) is a chemical compound with the molecular formula C12H15BCl2O2 and a molecular weight of 273.0 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: DTAZBCNEXKOLPE-UHFFFAOYSA-N.
| Molecular formula | C12H15BCl2O2 |
|---|---|
| Molecular weight | 273.0 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | DTAZBCNEXKOLPE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)