cas: 288101-48-4 — see every product listed under this CAS number, including other names
2-(2,4-Difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98% (CAS 288101-48-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 500g, 1g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A772962-5g |
| cas | 288101-48-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 500g | 3485.38 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 25g | 331.44 Pln | |
| Ambeed | 100g | 921.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A772962 |
2-(2,4-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 288101-48-4) is a chemical compound with the molecular formula C12H15BF2O2 and a molecular weight of 240.06 g/mol. IUPAC name: 2-(2,4-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HVKAOYLQBVBZDU-UHFFFAOYSA-N.
| Molecular formula | C12H15BF2O2 |
|---|---|
| Molecular weight | 240.06 g/mol |
| IUPAC name | 2-(2,4-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HVKAOYLQBVBZDU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)