CAS 288101-48-4 appears in our catalog under these names: 2,4–Difluorophenylboronic acid pinacol ester, 2-(2,4-Difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98%, 2-(2,4-Difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%, 2-(2,4-Difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 10g, 25g, 5g, 500g, 1g.
2-(2,4-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 288101-48-4) is a chemical compound with the molecular formula C12H15BF2O2 and a molecular weight of 240.06 g/mol. IUPAC name: 2-(2,4-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HVKAOYLQBVBZDU-UHFFFAOYSA-N.
| Molecular formula | C12H15BF2O2 |
|---|---|
| Molecular weight | 240.06 g/mol |
| IUPAC name | 2-(2,4-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HVKAOYLQBVBZDU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)