cas: 391604-55-0 — see every product listed under this CAS number, including other names
2-(2,4-Difluorophenyl)pyridine, 98%, 98% (CAS 391604-55-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148IA-1g |
| cas | 391604-55-0 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 10g | 150.80 Pln | |
| Chemat | 25g | 275.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(2,4-difluorophenyl)pyridine (CAS 391604-55-0) is a chemical compound with the molecular formula C11H7F2N and a molecular weight of 191.18 g/mol. IUPAC name: 2-(2,4-difluorophenyl)pyridine. InChIKey: SSABEFIRGJISFH-UHFFFAOYSA-N.
| Molecular formula | C11H7F2N |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 2-(2,4-difluorophenyl)pyridine |
| InChIKey | SSABEFIRGJISFH-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)