CAS 387831-85-8 appears in our catalog under these names: 2-(3,4-Difluorophenyl)pyridine, 95%, 2-(3,4-Difluorophenyl)pyridine. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2-(3,4-difluorophenyl)pyridine (CAS 387831-85-8) is a chemical compound with the molecular formula C11H7F2N and a molecular weight of 191.18 g/mol. IUPAC name: 2-(3,4-difluorophenyl)pyridine. InChIKey: PAHNEUIHKIUNGX-UHFFFAOYSA-N.
| Molecular formula | C11H7F2N |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 2-(3,4-difluorophenyl)pyridine |
| InChIKey | PAHNEUIHKIUNGX-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)