cas: 1256781-64-2 — see every product listed under this CAS number, including other names
2-(2,5-Dibromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 97% (CAS 1256781-64-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A183449-250mg |
| cas | 1256781-64-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 181.25 Pln | |
| Ambeed | 5g | 515.00 Pln | |
| Ambeed | 10g | 843.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A183449 |
2-(2,5-dibromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1256781-64-2) is a chemical compound with the molecular formula C12H15BBr2O2 and a molecular weight of 361.87 g/mol. IUPAC name: 2-(2,5-dibromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: YAZONGAJMOABEV-UHFFFAOYSA-N.
| Molecular formula | C12H15BBr2O2 |
|---|---|
| Molecular weight | 361.87 g/mol |
| IUPAC name | 2-(2,5-dibromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | YAZONGAJMOABEV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)Br)Br |
Computed by PubChem (NCBI)