CAS 1256781-64-2 appears in our catalog under these names: 2-(2,5-Dibromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 97%, 2-(2,5-Dibromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 2-(2,5-Dibromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg.
2-(2,5-dibromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1256781-64-2) is a chemical compound with the molecular formula C12H15BBr2O2 and a molecular weight of 361.87 g/mol. IUPAC name: 2-(2,5-dibromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: YAZONGAJMOABEV-UHFFFAOYSA-N.
| Molecular formula | C12H15BBr2O2 |
|---|---|
| Molecular weight | 361.87 g/mol |
| IUPAC name | 2-(2,5-dibromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | YAZONGAJMOABEV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)Br)Br |
Computed by PubChem (NCBI)