2-(2,7-Difluoro-6-hydroxy-3-oxo-3H-xanthen-9-yl)benzoic Acid, 98%
cas: 913689-08-4 — see every product listed under this CAS number, including other names
2-(2,7-Difluoro-6-hydroxy-3-oxo-3H-xanthen-9-yl)benzoic Acid, 98% (CAS 913689-08-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 25mg, 50mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1279499-100mg |
| cas | 913689-08-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 2066.94 Pln | |
| Ambeed | 250mg | 3452.00 Pln | |
| Ambeed | 1g | 9186.94 Pln | |
| Chemat | 25mg | 678.80 Pln | |
| Chemat | 50mg | 1106.00 Pln | |
| Chemat | 100mg | 1835.60 Pln | |
| Chemat | 250mg | 3074.00 Pln | |
| Chemat | 1g | 8195.60 Pln | |
| BLDpharm | 25mg | 747.54 Pln | |
| BLDpharm | 50mg | 1225.15 Pln | |
| BLDpharm | 100mg | 2019.31 Pln | |
| BLDpharm | 250mg | 3385.50 Pln | |
| BLDpharm | 1g | 9005.74 Pln | |
| Fluorochem | 25mg | 1257.91 Pln | |
| Fluorochem | 50mg | 2049.30 Pln | |
| Fluorochem | 100mg | 3392.57 Pln | |
| Fluorochem | 250mg | 5699.05 Pln | |
| Fluorochem | 1g | 14961.42 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
2',7'-difluorofluorescein is a xanthene dye that is fluorescein bearing two fluoro substituents at positions 2' and 7'. It has a role as a fluorochrome.
Source: ChEBI
| Molecular formula | C20H10F2O5 |
|---|---|
| Molecular weight | 368.3 g/mol |
| IUPAC name | 2-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| InChIKey | VGIRNWJSIRVFRT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=C3C=C(C(=O)C=C3OC4=CC(=C(C=C42)F)O)F)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2',7'-difluorofluorescein, 2-(2,7-difluoro-6-hydroxy-3-oxo-3H-xanthen-9-yl)benzoic acid, 2-(2,7-difluoro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid, MolMap_000040, 2-(2,7-difluoro-3-hydroxy-6-oxo-xanthen-9-yl)benzoic acid, Benzoic acid, 2-(2,7-difluoro-6-hydroxy-3-oxo-3H-xanthen-9-yl)-, Benzoic acid, 2-(2,7-difluoro-6-hydroxy-3-oxo-3H-xanthen-9-yl)- (9CI)